Jump to content

Terphenyl: Difference between revisions

Content deleted Content added
Adding ball-and-stick model
ref
 
(49 intermediate revisions by 30 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| Verifiedfields = changed
| Name =''para''-Terphenyl
| Watchedfields = changed
| Reference =
| verifiedrevid = 392374283
| ImageFile = Para-terphenyl.png
| Name =''para''-Terphenyl
| ImageSize = 200px
| Reference =
| ImageName = Skeletal formula of para-terphenyl
| ImageFile1 = Para-terphenyl-3D-balls.png
| = Para-terphenyl.png
| ImageSize1 = 200px
| =
| ImageName1 = Ball-and-stick model of para-terphenyl
| = of para-terphenyl
| ImageFile1 = Para-terphenyl-from-xtal-view-2-3D-bs-17.png
| IUPACName = 1,4-Diphenylbenzene
| ImageSize1 =
| OtherNames=''p''-Terphenyl; 1,4-Diphenylbenzene; ''para''-Diphenylbenzene; ''p''-Diphenylbenzene; ''para''-Triphenyl; ''p''-Triphenyl
| = of para-terphenyl
| PIN = 1<sup>1</sup>,2<sup>1</sup>:2<sup>4</sup>,3<sup>1</sup>-Terphenyl<ref name=iupac2013>{{cite book | title = Nomenclature of Organic Chemistry : IUPAC Recommendations and Preferred Names 2013 (Blue Book) | publisher = [[Royal Society of Chemistry|The Royal Society of Chemistry]] | date = 2014 | location = Cambridge | page = 345 | doi = 10.1039/9781849733069-00130 | isbn = 978-0-85404-182-4}}</ref>
| OtherNames=''p''-Terphenyl 1,4-Diphenylbenzene ''para''-Diphenylbenzene ''p''-Diphenylbenzene ''para''-Triphenyl ''p''-Triphenyl
|Section1={{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=92-94-4
| CASNo=92-94-4
| CASOther= (''para'')<br>92-06-8 (''meta'')<br>84-15-1 (''ortho'')<br>26140-60-3 (unspec.)
| CASNo_Comment = (''para'')
| PubChem=7115
| CASNo2_Ref = {{cascite|correct|CAS}}
| SMILES=C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3
| CASNo2 = 92-06-8
| CASNo2_Comment = (''meta'')
| CASNo3_Ref = {{cascite|correct|CAS}}
| CASNo3 = 84-15-1
| CASNo3_Comment = (''ortho'')
| CASNo4_Ref = {{cascite|correct|CAS}}
| CASNo4 = 26140-60-3
| CASNo4_Comment = (unspecified)
| Beilstein = 1908447
| ChEMBL1 = 491582
| ChEBI1 = 52242
| PubChem =7115
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 6848
| ChemSpiderID_Comment = (''para'')
| EC_number1 = 202-205-2
| RTECS1 = WZ6475000
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = GWP218ZY6F
| UNII_Comment = (''para'')
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII2 = WOI2PSS0KX
| UNII2_Comment = (''meta'')
| UNII3_Ref = {{fdacite|correct|FDA}}
| UNII3 = W5675R7KVW
| UNII3_Comment = (''ortho'')
| UNII4_Ref = {{fdacite|correct|FDA}}
| UNII4 = LFX1C55D2Z
| UNII4_Comment = (unspecified)
| SMILES=C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3
| SMILES2 = c1ccc(cc1)c2ccc(cc2)c3ccccc3
| SMILES2_Comment = (''para'')
| InChI = 1/C18H14/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1-14H
| InChI_Comment = (''para'')
| InChIKey = XJKSTNDFUHDPQJ-UHFFFAOYAJ
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C18H14/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1-14H
| StdInChI_Comment = (''para'')
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = XJKSTNDFUHDPQJ-UHFFFAOYSA-N
}}
}}
|Section2={{Chembox Properties
|Section2={{Chembox Properties
| C=18|H=14
| C=18|H=14
| Appearance=White powder<ref name=chemicalland21>[http://chemicalland21.com/industrialchem/IUH/p-TERPHENYL.htm ''p''-Terphenyl] at chemicalland21.com</ref>
| =White powder<ref name=chemicalland21/>
| Density=
| Density=
| MeltingPtC = 212 to 214
| MeltingPt=212-214 °C<ref name=chemicalland21/><br>212-213 °C<ref name=Sigma>[http://www.sigmaaldrich.com/catalog/ProductDetail.do?lang=en&N4=257389|SIAL&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC ''p''-Terphenyl] at [[Sigma-Aldrich]]</ref>
| = <ref name=chemicalland21/><br>212-213 °C<ref name=Sigma>[http://www.sigmaaldrich.com/catalog/?lang=en&= ''p''-Terphenyl] at [[Sigma-Aldrich]]</ref>
| BoilingPt=389 °C<ref name=Sigma/>
| BoilingPtC = 389
| Solubility=Insoluble<ref name=chemicalland21/>
| = <ref name=Sigma/>
| Solubility=Insoluble<ref name=chemicalland21/>
| RefractIndex = 1.65<ref name="Cryos Beta">{{cite web | url = http://www.cryos-beta.kharkov.ua/organic.php | title = Organic molecular single crystals | publisher = cryos-beta.kharkov.ua }}</ref>
}}
}}
|Section3={{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards=Iritant ('''Xi''')
| FlashPtC = 207
| FlashPt=207 °C<ref name=Sigma/>
| = <ref name=Sigma/>
| Autoignition=
| AutoignitionPt =
| RPhrases = {{R36/37/38}} {{R50/53}}
| SPhrases = {{S26}} {{S60}} {{S61}}
| = {{}}{{}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|315|319|335|400}}
| PPhrases = {{P-phrases|261|264|271|273|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|391|403+233|405|501}}
| NFPA-H = 2
| NFPA-F = 1
| NFPA-R = 0
| PEL = C 9 mg/m<sup>3</sup> (1 ppm)<ref>{{PGCH|0591}}</ref><ref>{{PGCH|0592}}</ref><ref>{{PGCH|0593}}</ref>
}}
}}
}}
}}


'''Terphenyls''' are a group of closely-related [[aromaticity|aromatic]] [[hydrocarbons]]. Also known as '''diphenylbenzenes''' or '''triphenyls''', they consist of a central [[benzene]] ring substituted with two [[phenyl group]]s. The three isomers are ''ortho''-terphenyl, ''meta''-terphenyl, and ''para''-terphenyl. Commercial grade terphenyl is generally a mixture of the three isomers. This mixture is used in the production of [[polychlorinated terphenyl]]s, which were formerly used as heat storage and transfer agents.<ref name=chemicalland21/>
'''Terphenyls''' are a group of closelyrelated [[aromatic hydrocarbons]]. Also known as '''diphenylbenzenes''' or '''triphenyls''', they consist of a central [[benzene]] ring substituted with two [[phenyl group]]s. three ''ortho''-terphenyl, ''meta''-terphenyl, and ''para''-terphenyl. Commercial grade terphenyl is generally a mixture of the three . This mixture is used in the production of [[polychlorinated terphenyl]]s, which were formerly used as heat storage and transfer agents.<ref name=chemicalland21/>

''p''-Terphenyl is the most common isomer. It is used as a laser dye and a sunscreen ingredient.<ref name=chemicalland21/>


''p''-Terphenyl derivatives are found in various fungi and bacteria. One example is [[atromentin]], a pigment found in some mushrooms. These natural ''p''-terphenyls are better described as diphenylquinones or diphenylhydroquinones. Some m-terphenyl compounds occur in plants.<ref>{{cite journal |doi=10.1021/cr050248c |title=Natural Terphenyls: Developments since 1877 |date=2006 |last1=Liu |first1=Ji-Kai |journal=Chemical Reviews |volume=106 |issue=6 |pages=2209–2223 |pmid=16771447 }}</ref>
<gallery>
<gallery>
File:ortho-terphenyl.png|''ortho''-Terphenyl
File:ortho-terphenyl.png|''ortho''-Terphenyl
Line 44: Line 96:


==See also==
==See also==
* [[Diphenyl]]
* [[]]
* [[Terpyridine]]
* [[Terpyridine]]
* [[Terthiophene]]
* [[Terthiophene]]
Line 53: Line 105:
==External links==
==External links==
* [http://omlc.ogi.edu/spectra/PhotochemCAD/html/p-terphenyl.html p-Terphenyl] at the Oregon Laser Medical Center
* [http://omlc.ogi.edu/spectra/PhotochemCAD/html/p-terphenyl.html p-Terphenyl] at the Oregon Laser Medical Center
* [https://www.cdc.gov/niosh/npg/npgd0591.html o-Terphenyl], [https://www.cdc.gov/niosh/npg/npgd0592.html m-Terphenyl], [https://www.cdc.gov/niosh/npg/npgd0593.html p-Terphenyl] at Centers for Disease Control and Prevention, National Institute for Occupational Safety and Health


[[Category:Aromatic compounds]]
[[Category:Aromatic ]]
[[Category:Hydrocarbons]]
[[Category:]]

[[de:Terphenyle]]
[[nl:Terfenyl]]