Benperidol: Difference between revisions
Appearance
Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'CAS_number'). |
No edit summary |
||
(58 intermediate revisions by 37 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Typical antipsychotic medication}} |
|||
{{Drugbox |
|||
{{Infobox drug |
|||
| Verifiedfields = changed |
|||
| Verifiedfields = changed |
|||
| verifiedrevid = 413884012 |
|||
| verifiedrevid = 459533587 |
|||
| IUPAC_name = 1-{1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl}-1,3-dihydro-2''H''-benzimidazol-2-one |
|||
| IUPAC_name = 1-{1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl}-1,3-dihydro-2''H''-benzimidazol-2-one |
|||
| image = Benperidol.svg |
|||
| image = Benperidol.svg |
|||
| width = 250 |
|||
| alt = Skeletal formula of benperidol |
|||
| width = 240 |
|||
| image2 = Benperidol 3D ball.png |
|||
| alt2 = Ball-and-stick model of the benperidol molecule |
|||
| width2 = 250 |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| Drugs.com = {{drugs.com|international|benperidol}} |
| Drugs.com = {{drugs.com|international|benperidol}} |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_AU = [[Standard for the Uniform Scheduling of Medicines and Poisons#Schedule 4|S4]] (Prescription only) |
|||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
|||
| legal_UK |
| legal_UK / P / POM / CD --> |
||
| legal_US = Rx-only |
| legal_US = Rx-only |
||
| legal_status |
| legal_status |
||
| routes_of_administration = Oral |
| routes_of_administration = Oral |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability |
| bioavailability |
||
| protein_bound |
| protein_bound |
||
| metabolism |
| metabolism |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion |
| excretion |
||
| CAS_number_Ref = {{cascite|changed|??}} |
|||
| CAS_number = 2062-84-2 |
|||
<!--Identifiers--> |
|||
| ATC_prefix = N05 |
|||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| ATC_suffix = AD07 |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| PubChem = 16363 |
|||
| CAS_number = <!-- blanked - oldvalue: 983-42-6 --> |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| ATC_prefix = N05 |
|||
| DrugBank = DB12867 |
|||
| ATC_suffix = AD07 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| PubChem = 16363 |
|||
| ChemSpiderID = 15521 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| DrugBank = |
|||
| UNII = 97O6X78C53 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChemSpiderID = 15521 |
|||
| ChEMBL = 297302 |
|||
| UNII_Ref = {{fdacite|changed|FDA}} |
|||
| KEGG = D02627 |
|||
| UNII = 97O6X78C53 |
|||
| ChEBI = 93403 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 297302 |
|||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C |
| C = |
||
| H = 24 |
|||
| molecular_weight = 381.443 g/mol |
|||
| F = 1 |
|||
| smiles = Fc1ccc(cc1)C(=O)CCCN4CCC(N3c2ccccc2NC3=O)CC4 |
|||
| N = 3 |
|||
| InChI = 1/C22H24FN3O2/c23-17-9-7-16(8-10-17)21(27)6-3-13-25-14-11-18(12-15-25)26-20-5-2-1-4-19(20)24-22(26)28/h1-2,4-5,7-10,18H,3,6,11-15H2,(H,24,28) |
|||
| O = 2 |
|||
| InChIKey = FEBOTPHFXYHVPL-UHFFFAOYAW |
|||
| smiles = Fc1ccc(cc1)C(=O)CCCN4CCC(N3c2ccccc2NC3=O)CC4 |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C22H24FN3O2/c23-17-9-7-16(8-10-17)21(27)6-3-13-25-14-11-18(12-15-25)26-20-5-2-1-4-19(20)24-22(26)28/h1-2,4-5,7-10,18H,3,6,11-15H2,(H,24,28) |
|||
| StdInChI = 1S/C22H24FN3O2/c23-17-9-7-16(8-10-17)21(27)6-3-13-25-14-11-18(12-15-25)26-20-5-2-1-4-19(20)24-22(26)28/h1-2,4-5,7-10,18H,3,6,11-15H2,(H,24,28) |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = FEBOTPHFXYHVPL-UHFFFAOYSA-N |
|||
| StdInChIKey = FEBOTPHFXYHVPL-UHFFFAOYSA-N |
|||
| drug_name = |
|||
| caption = |
|||
| type = |
|||
| MedlinePlus = |
|||
| licence_EU = |
|||
| licence_US = |
|||
}} |
}} |
||
'''Benperidol''' |
'''Benperidol''' 3 </ref> is [[antipsychotic]], can be used [[schizophrenia]]<ref> Bobon J, Collard J, Lecoq R Benperidol and promazine: a "double blind" comparative study in mental geriatrics Acta 63</ref> is [[]] [[]]<ref> , </ref> is sometimes prescribed to [[sex offender]]s as a condition of their [[parole]], as an alternative to [[androgen]] drugs such as [[cyproterone]].<ref>Murray MA, Bancroft JH, Anderson DC, Tennent TG, Carr PJ Endocrine changes in male sexual deviants after treatment with anti-androgens, oestrogens or tranquillizers Journal of Endocrinology 672.</ref> |
||
Benperidol was discovered by [[Janssen Pharmaceutica]] in 1961 and has been marketed since 1966. It is mainly used in [[Germany]], but it is also available in [[Belgium]], [[Greece]], [[Italy]], the [[Netherlands]], and the [[United Kingdom]].<ref>{{Cite web | title = NCATS Inxight Drugs — BENPERIDOL | access-date = 13 March 2022 | url = https://drugs.ncats.io/drug/97O6X78C53}}</ref> |
|||
Benperidol was discovered at [[Janssen Pharmaceutica]] in 1961. |
|||
== Pharmacology == |
|||
=== Pharmacodynamics === |
|||
Benperidol is a strong [[dopamine]] [[receptor antagonist]] ([[Dopamine receptor D2|D<sub>2</sub>]] (''K''<sub>i</sub> 0.027 nM) and [[Dopamine receptor D4|D<sub>4</sub>]] (''K''<sub>i</sub> 0.066 nM))<ref name=":1" /> with weaker [[serotonin]] receptor antagonism ([[5-HT2A receptor|5-HT<sub>2A</sub>]] (''K''<sub>i</sub> 3.75 nM)).<ref name=":1" /> In high doses, it has antihistaminergic and alpha-adrenergic properties. It possesses minimal anticholinergic properties.<ref name=":0">{{cite journal | vauthors = Leucht S, Hartung B | title = Benperidol for schizophrenia | journal = The Cochrane Database of Systematic Reviews | volume = 2005 | issue = 2 | pages = CD003083 | date = April 2005 | pmid = 15846648 | pmc = 7017029 | doi = 10.1002/14651858.CD003083.pub2 }}</ref> |
|||
{| class="wikitable" |
|||
|+Benperidol<ref name="PDSP">{{cite web | title = PDSP K<sub>i</sub> Database | work = Psychoactive Drug Screening Program (PDSP)| author1-link = Bryan Roth | vauthors = Roth BL, Driscol J | publisher = University of North Carolina at Chapel Hill and the United States National Institute of Mental Health | access-date = 11 March 2022 | url = https://pdsp.unc.edu/databases/pdsp.php?recDDRadio=recDDRadio&receptorDD=&receptor=&speciesDD=&species=&sourcesDD=&source=&hotLigandDD=&hotLigand=&testLigandDD=&testFreeRadio=testFreeRadio&testLigand=Benperidol&referenceDD=&reference=&KiGreater=&KiLess=&kiAllRadio=all&doQuery=Submit+Query}}</ref> |
|||
! Site !! K<sub>i</sub> (nM) !! Action !! Ref |
|||
|- |
|||
| [[5-HT2A receptor|5-HT<sub>2A</sub>]] || 3.75 || Antagonist ||<ref name=":1">{{cite journal | vauthors = Li P, Snyder GL, Vanover KE | title = Dopamine Targeting Drugs for the Treatment of Schizophrenia: Past, Present and Future | journal = Current Topics in Medicinal Chemistry | volume = 16 | issue = 29 | pages = 3385–3403 | date = December 2016 | pmid = 27291902 | pmc = 5112764 | doi = 10.2174/1568026616666160608084834 }}</ref> |
|||
|- |
|||
| [[Dopamine D1 receptor|D<sub>1</sub>]] || 4,100 || Antagonist ||<ref name=":1" /> |
|||
|- |
|||
| [[Dopamine D2 receptor|D<sub>2</sub>]] || 0.027 || Antagonist ||<ref name=":1" /> |
|||
|- |
|||
| [[Dopamine D4 receptor|D<sub>4</sub>]] || 0.06 || Antagonist ||<ref name=":1" /> |
|||
|} |
|||
=== Pharmacokinetics === |
|||
Benperidol is absorbed well and undergoes extensive [[First pass effect|first pass metabolism]]. One percent of benperidol is excreted in urine. The half-life of benperidol is 8 hours.<ref name=":0" /> |
|||
==Synthesis== |
|||
4-(2-Keto-1-benzimidazolinyl)piperidine ('''1''') is alkylated with 4-chloro-4'-Fluorobutyrophenone ('''2''') to produce benperidol ('''3''').<ref>[https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-02-0036 Thieme]</ref><ref name=":2">{{Cite patent | country = BE | number = 626307}} (1963 to Janssen), C.A. 60, 10690c (1964), corresp. to {{cite patent | country = GB | number = 989755 | pubdate = 1965-04-22 | title = 1-(1-aroylpropyl-4-piperidyl)-2-benzimidazolinones and related compounds | assign1 = [[Janssen Pharmaceuticals#History|N.V. Research Laboratorium Dr. C. Janssen]]}}</ref> |
|||
[[File:Benperidol synthesis.svg|thumb|center|501px|]] |
|||
==See also== |
|||
*[[Timiperone]] has a similar [[chemical structure]] with a [[thiourea]] [[Functional group|group]] instead of a [[urea]] group. |
|||
*[[Pimozide]], [[bezitramide]], [[oxiperomide]], and [[neflumozide]]) are also made from 4-(1-benzimidazolinone)piperidine precursor |
|||
*[[Droperidol]] is similar, but has a [[Wikt:tetrahydropyridine|tetrahydropyridine]] ring. |
|||
== References == |
== References == |
||
{{Reflist|2}} |
{{Reflist|2}} |
||
{{Antipsychotics}} |
{{Antipsychotics}} |
||
{{Dopaminergics}} |
{{Dopaminergics}} |
||
[[Category:Belgian inventions]] |
|||
[[Category:Piperidines]] |
|||
[[Category:Organofluorides]] |
|||
[[Category:Benzimidazoles]] |
[[Category:Benzimidazoles]] |
||
[[Category:Butyrophenone antipsychotics]] |
[[Category:Butyrophenone antipsychotics]] |
||
[[Category:Janssen Pharmaceutica]] |
[[Category:Janssen Pharmaceutica]] |
||
[[Category:Fluoroarenes]] |
|||
[[Category:Piperidines]] |
|||
[[Category:Typical antipsychotics]] |
|||
{{nervous-system-drug-stub}} |
|||
[[bar:Benperidol]] |
|||
[[de:Benperidol]] |
|||
[[ru:Бенперидол]] |