Benidipine: Difference between revisions

{{Short description|Antihypertensive drug of the calcium channel blocker class}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444524924

| IUPAC_name = O5-methyl O3-[(3''R'')-1-(phenylmethyl)piperidin-3-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate

| image = Benidipine structure.svg

| alt = Skeletal formula of benidipine

| width = 250px

| image2 = Benidipine-3D-balls.png

| alt2 = Ball-and-stick model of the benidipine molecule

<!--Clinical data-->

| tradename =

| Drugs.com = {{drugs.com|international|benidipine}}

| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->

| pregnancy_US = <!-- A / B / C / D / X -->

| pregnancy_category =

| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->

| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->

| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->

| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->

| legal_status =

| routes_of_administration = By mouth

<!--Pharmacokinetic data-->

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

<!--Identifiers-->

| PubChem = 656668

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 571013

| smiles = [O-][N+](=O)c1cccc(c1)[C@@H]4C(/C(=O)OC)=C(\N\C(=C4\C(=O)O[C@@H]3CCCN(Cc2ccccc2)C3)C)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C28H31N3O6/c1-18-24(27(32)36-3)26(21-11-7-12-22(15-21)31(34)35)25(19(2)29-18)28(33)37-23-13-8-14-30(17-23)16-20-9-5-4-6-10-20/h4-7,9-12,15,23,26,29H,8,13-14,16-17H2,1-3H3/t23-,26-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QZVNQOLPLYWLHQ-ZEQKJWHPSA-N

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 105979-17-7

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2218858

| ATC_prefix = C08

| ATC_suffix = CA15

| ATC_supplemental =

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

<!--Chemical data-->

<!-- Definition and medical uses -->

'''Benidipine''' is a dihydropyridine calcium channel blocker for the treatment of [[Hypertension|high blood pressure (hypertension)]]. It is a triple <small>L</small>-, <small>T</small>-, and <small>N</small>-type [[calcium channel blocker]]. It is reno- and cardioprotective.

<!-- Society and culture -->

It was patented in 1981 and approved for medical use in 1991.<ref>{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=465 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA465 |language=en}}</ref>

Benidipine is dosed as mg once daily.<ref>{{cite web | url = http://www.mims-online.com/Page.aspx?menuid=mng&name=Coniel%20film-coated%20tab | title = Coniel (benidipine) package insert (Philippines) | author = Hi-Eisai Pharmaceutical, Inc. | = 2008-03-31 | publisher = CMPMedica | work = MIMS Philippines}}</ref>

====

Benidipine is .

Benidipine has additionally been found to act as an [[receptor antagonist|antagonist]] of the [[mineralocorticoid receptor]], or as an [[antimineralocorticoid]].<ref name="Luther2014">{{cite journal | vauthors = Luther JM | title = Is there a new dawn for selective mineralocorticoid receptor antagonism? | journal = Current Opinion in Nephrology and Hypertension | volume = 23 | issue = 5 | pages = 456–61 | date = September 2014 | pmid = 24992570 | pmc = 4248353 | doi = 10.1097/MNH.0000000000000051 }}</ref>

====

Other names include Benidipinum or benidipine hydrochloride.

Benidipine is sold as Coniel by Kyowa Hakko Kogyo.

Benidipine is initially licensed for use in Japan and selected [[South East Asia|Southeast Asian]] countries and later in Turkey, where it is sold as 4&nbsp;mg tablets.

== References ==

{{Reflist}}

{{Channelergics}}

{{Mineralocorticoidics}}

[[Category:Antimineralocorticoids]]

[[Category:]]

[[Category:Nitrobenzene derivatives]]

[[Category:Piperidines]]